A5461812
5-Methoxy-1-tetralone , 98% , 33892-75-0
CAS NO.:33892-75-0
Empirical Formula: C11H12O2
Molecular Weight: 176.21
MDL number: MFCD00001692
EINECS: 251-723-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB384.80 | In Stock |
|
| 100g | RMB1396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91 °C(lit.) |
| Boiling point: | 160-162 °C7 mm Hg(lit.) |
| Density | 1.0431 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| Flash point: | 160-162°C/7mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2047383 |
| InChI | InChI=1S/C11H12O2/c1-13-11-7-3-4-8-9(11)5-2-6-10(8)12/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | BRCPWISABURVIH-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(OC)=CC=C2)CCC1 |
| CAS DataBase Reference | 33892-75-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Methoxy-1-tetralone(33892-75-0) |
Description and Uses
5-Methoxy-1-tetralone is used in the preparation of hydroxy ketone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | QK4800000 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |






