A5481712
Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate , 98% , 7355-18-2
CAS NO.:7355-18-2
Empirical Formula: C15H20O11
Molecular Weight: 376.31
MDL number: MFCD00069834
EINECS: 230-880-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25g | RMB329.60 | In Stock |
|
| 100g | RMB1214.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179 °C |
| Boiling point: | 412.3±45.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| refractive index | 8.0 ° (C=1, CHCl3) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11-,12-,13+,15+/s3 |
| InChIKey | DPOQCELSZBSZGX-LFBIYFKTNA-N |
| SMILES | O([C@@H]1[C@H]([C@H](OC(=O)C)O[C@H](C(=O)OC)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,9,14,r| |
| CAS DataBase Reference | 7355-18-2(CAS DataBase Reference) |
Description and Uses
1,2,3,4-Tetra-O-acetyl-β-D-glucuronic Acid Methyl Ester (cas# 7355-18-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 |
| WGK Germany | 3 |
| HS Code | 29329990 |





