A5482112
(1R,2S,5R)-(-)-Menthyl (S)-p-Toluenesulfinate , 98% , 1517-82-4
Synonym(s):
(−)-(1R)-Menthyl (S)-p-toluenesulfinate;(S)-(−)-Menthyl p-toluenesulfinate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB226.08 | In Stock |
|
| 25G | RMB944.00 | In Stock |
|
| 100G | RMB3024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-104 °C |
| Boiling point: | 402.3±38.0 °C(Predicted) |
| Density | 1.08 |
| refractive index | -199 ° (C=1.5, Acetone) |
| storage temp. | -20°C |
| solubility | Acetone (Slightly), Chloroform (Slightly) |
| form | Solution |
| color | Yellow to brown or gray |
| optical activity | [α]20/D 195°, c = 2 in acetone |
| BRN | 3207468 |
| InChI | 1S/C17H26O2S/c1-12(2)16-10-7-14(4)11-17(16)19-20(18)15-8-5-13(3)6-9-15/h5-6,8-9,12,14,16-17H,7,10-11H2,1-4H3/t14-,16+,17-,20+/m1/s1 |
| InChIKey | NQICGNSARVCSGJ-ASKNOMKYSA-N |
| SMILES | C[C@@H]1CC[C@@H](C(C)C)[C@@H](C1)OS(=O)c2ccc(C)cc2 |
Description and Uses
(1R,2S,5R)-(-)-Menthyl (S)-p-toluenesulfinate can react with:
- metal ketimines to form enantiopure sulfinimines
- p-(methylthio)benzaldehyde to form (S)-(-)-N-(4-methylthiobenzylidene)-p-toluenesulfinimine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
