A5483312
2-Methylallylmagnesium chloride solution , 0.5MinTHF , 5674-01-1
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB71.20 | In Stock |
|
| 100ML | RMB134.40 | In Stock |
|
| 500ML | RMB435.20 | In Stock |
|
| 1L | RMB779.20 | In Stock |
|
| 4×25ml | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65-67 °C |
| Density | 0.915 g/mL at 25 °C |
| Flash point: | −6 °F |
| solubility | sol ether, THF |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C4H7.ClH.Mg/c1-4(2)3;;/h1-2H2,3H3;1H;/q;;+1/p-1 |
| InChIKey | BJVFGWYBOLMUEM-UHFFFAOYSA-M |
| SMILES | C([Mg]Cl)C(=C)C |
Description and Uses
2-Methylallylmagnesium chloride is a general Grignard reagent used in the synthesis of (?)-aplysin, acutumine, dimedol and allyldicyclopentadienyltitanium(III) complexes.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H261-H302-H314-H335-H351 |
| Precautionary statements | P210-P231+P232-P280-P370+P378-P402+P404-P403+P235 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,C,Xn |
| Risk Statements | 11-14/15-19-20/21/22-34-40-36/37/38 |
| Safety Statements | 16-26-27-36/37/39-45-43-36/37 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | - |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 2 |









