A5484412
N-Methyl-bis(trifluoroacetamide) , Used for GC derivatives, 98% , 685-27-8
Synonym(s):
MBTFA;MBTFA (N-methyl-bis(trifluoroacetamide)or BTFA (bis(TFA))
CAS NO.:685-27-8
Empirical Formula: C5H3F6NO2
Molecular Weight: 223.07
MDL number: MFCD00000412
EINECS: 211-680-5
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB311.20 | In Stock |
|
| 5ML | RMB1039.20 | In Stock |
|
| 25ML | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 121-122 °C(lit.) |
| Density | 1.547 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 42 °C |
| storage temp. | 2-8°C |
| pka | -3.38±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.547 |
| Sensitive | Moisture Sensitive |
| BRN | 1878402 |
| InChI | 1S/C5H3F6NO2/c1-12(2(13)4(6,7)8)3(14)5(9,10)11/h1H3 |
| InChIKey | AWGBWLXGUPTXHF-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| CAS DataBase Reference | 685-27-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamide, 2,2,2-trifluoro-n-methyl-n-(trifluoroacetyl)-(685-27-8) |
Description and Uses
Reagent for introducing trifluoroacetyl group.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34-44 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29241990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








