PRODUCT Properties
| Melting point: | 79.0 to 83.0 °C |
| Boiling point: | 280.3±35.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 0.02±0.18(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C7H8N2O3/c1-5-3-7(12-2)8-4-6(5)9(10)11/h3-4H,1-2H3 |
| InChIKey | DJNQRLCFAHKFLZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(cn1)[N+]([O-])=O |
| CAS DataBase Reference | 6635-90-1(CAS DataBase Reference) |
Description and Uses
2-Methoxy-4-methyl-5-nitropyridine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-37/39-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
