A5496612
2-Methoxy-6-methylaniline , 98% , 50868-73-0
Synonym(s):
6-Methyl-o-anisidine
| Pack Size | Price | Stock | Quantity |
| 5G | RMB247.20 | In Stock |
|
| 25G | RMB1007.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 26-29 °C (lit.) |
| Boiling point: | 62 °C/0.15 mmHg (lit.) |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 4.39±0.10(Predicted) |
| color | Clear Brown Oil to Pale Red to Dark Red |
| InChI | InChI=1S/C8H11NO/c1-6-4-3-5-7(10-2)8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | HKOJYPPTIPJZAZ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=CC=C1OC |
| CAS DataBase Reference | 50868-73-0 |
Description and Uses
2-Methoxy-6-methylaniline may be used in the synthesis of 7-methoxy-1H-indazole, an inhibitor of nitric oxide synthase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2922290090 |







