PRODUCT Properties
| Melting point: | 67-69 °C (lit.) |
| BRN | 2702653 |
| InChI | 1S/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
| InChIKey | HCEIEWYPDCDNNU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1[N+]([O-])=O |
| EPA Substance Registry System | Benzoic acid, 3,4,5-trimethoxy-2-nitro-, methyl ester (5081-42-5) |
Description and Uses
Methyl 2-nitro-3,4,5-trimethoxybenzoate has been used in preparation of 2-nitro-3,4,5-trimethoxybenzoic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181990 |
| Storage Class | 13 - Non Combustible Solids |
