A5496812
3-Methoxy-4-nitrobenzoic acid , 98% , 5081-36-7
CAS NO.：5081-36-7
Empirical Formula: C8H7NO5
Molecular Weight: 197.14
MDL number: MFCD00007353
EINECS: 225-793-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB162.40 | In Stock |
|
| 100g | RMB539.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235 °C (lit.) |
| Boiling point: | 334.23°C (rough estimate) |
| Density | 1.5023 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.30±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| BRN | 2696042 |
| InChI | InChI=1S/C8H7NO5/c1-14-7-4-5(8(10)11)2-3-6(7)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | PWURRRRGLCVBMX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(OC)=C1 |
| CAS DataBase Reference | 5081-36-7(CAS DataBase Reference) |
Description and Uses
3-Methoxy-4-nitrobenzoic acid was used in detection of nitroaromatic compounds by CdSe- quantum dots capped with polyamidoamine dendrimer-1,12-diaminododecane core-generation 4 nanocomposites. It was used in the synthesis of vorozole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| RIDADR | Cool, dry,tightly closed |
| WGK Germany | 3 |
| HS Code | 29189900 |
