A5497112
3-Methoxy-2-methylaniline , 98% , 19500-02-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB90.00 | In Stock |
|
| 5G | RMB205.20 | In Stock |
|
| 25G | RMB701.60 | In Stock |
|
| 100g | RMB1964.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-28°C |
| Boiling point: | 243.4±20.0 °C(Predicted) |
| Density | 1.08 |
| refractive index | 1.5730-1.5770 |
| Flash point: | >110℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 4.03±0.10(Predicted) |
| color | Brown to Dark Brown |
| InChI | InChI=1S/C8H11NO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,9H2,1-2H3 |
| InChIKey | OPXLVWLFDKRYRB-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(OC)=C1C |
| CAS DataBase Reference | 19500-02-8(CAS DataBase Reference) |
Description and Uses
3-Methoxy-2-methylaniline is a aniline derivative used in the preparation of indoles and indazoles with potential neurochemical activity, as well as in the preparation of quinoline based antiviral agents.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H301+H311+H331-H315-H319-H302 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P305+P351+P338+P337+P313-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | 2810 |
| WGK Germany | 1 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921490090 |
