A5497212
Methyl 3-(bromomethyl)benzoate , 97% , 1129-28-8
Synonym(s):
3-(Bromomethyl)benzoic acid methyl ester
CAS NO.：1129-28-8
Empirical Formula: C9H9BrO2
Molecular Weight: 229.07
MDL number: MFCD00051437
EINECS: 419-100-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-47 °C(lit.) |
| Boiling point: | 112-114 °C3 mm Hg(lit.) |
| Density | 1,47 g/cm3 |
| Flash point: | 115°C/0.8mm |
| storage temp. | 2-8°C |
| solubility | Methanol[soluble in] |
| form | Crystals or Crystalline Powder |
| color | White |
| Water Solubility | Slightly soluble in water. |
| BRN | 638569 |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-5H,6H2,1H3 |
| InChIKey | YUHSMQQNPRLEEJ-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC(CBr)=C1 |
| CAS DataBase Reference | 1129-28-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 3-bromomethylbenzoate(1129-28-8) |
Description and Uses
Methyl 3-(bromomethyl)benzoate is used in organic synthesis of other chemicals.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | 22-34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| F | 19 |
| Hazard Note | Irritant/Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
