PRODUCT Properties
| Melting point: | 67 °C |
| Boiling point: | 306.3 °C |
| Density | 1.094±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | -2.62±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C19H17N/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | IULUNTXBHHKFFR-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(C)C=C1 |
Description and Uses
4-Methyltriphenylamine (cas# 4316-53-4) is a useful reactant and reagent in organic reactions and synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2921.49.5000 |
