A5501812
4-Methoxybenzenediazonium tetrafluoroborate , 98% , 459-64-3
CAS NO.:459-64-3
Empirical Formula: C7H7BF4N2O
Molecular Weight: 221.95
MDL number: MFCD00011897
EINECS: 207-296-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB281.60 | In Stock |
|
| 25G | RMB1060.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-144 °C(lit.) |
| storage temp. | -20°C |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Decompose in water |
| λmax | 315nm(CHCl3)(lit.) |
| BRN | 3579591 |
| InChI | InChI=1S/C7H7N2O.BF4/c1-10-7-4-2-6(9-8)3-5-7;2-1(3,4)5/h2-5H,1H3;/q+1;-1 |
| InChIKey | CNKRQRKNUIYISU-UHFFFAOYSA-M |
| SMILES | [B-](F)(F)(F)F.C1(OC)=CC=C([N+]#N)C=C1 |
Description and Uses
4-Methoxybenzenediazonium tetrafluoroborate has been used in the preparation of azo coupled cyclic β-enaminones.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29270000 |






