![6-Methoxy-2-(4-methoxyphenyl)benzo[b]thiophene](https://img.chemicalbook.com/CAS/GIF/63675-74-1.gif)
A5503112
6-Methoxy-2-(4-methoxyphenyl)benzo[b]thiophene , 98% , 63675-74-1
CAS NO.：63675-74-1
Empirical Formula: C16H14O2S
Molecular Weight: 270.35
MDL number: MFCD02083138
EINECS: 264-408-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100g | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-197 °C(lit.) |
| Boiling point: | 435.7±35.0 °C(Predicted) |
| Density | 1.194±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C16H14O2S/c1-17-13-6-3-11(4-7-13)15-9-12-5-8-14(18-2)10-16(12)19-15/h3-10H,1-2H3 |
| InChIKey | HRWAGCVMOGWQJF-UHFFFAOYSA-N |
| SMILES | C12=CC(OC)=CC=C1C=C(C1=CC=C(OC)C=C1)S2 |
| CAS DataBase Reference | 63675-74-1(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of Reloxifene impurities
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | 3 |
| HS Code | 2934.99.4400 |
