PRODUCT Properties
| Melting point: | 32-36 °C(lit.) |
| Boiling point: | 89-90℃ (2 Torr) |
| Density | 1.058±0.06 g/cm3(Predicted) |
| refractive index | 1.5568 (589.3 nm 25℃) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | crystals |
| color | White |
| InChI | InChI=1S/C10H10O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h3-7H,1H2,2H3 |
| InChIKey | NUMHUJZXKZKUBN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C=C)C=C1 |
Description and Uses
Methyl 4-vinylbenzoate is used as a fluid component for enhancing ink stability in printing and also in preparing vinyl substituted beta-diketones. Further, it is used as an organic intermediate for pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
