A5503312
4-Methyl-1,10-phenanthroline , 97% , 31301-28-7
CAS NO.:31301-28-7
Empirical Formula: C13H10N2
Molecular Weight: 194.23
MDL number: MFCD00004978
EINECS: 625-820-1
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB78.40 | In Stock |
|
| 1G | RMB342.40 | In Stock |
|
| 5G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145 °C(lit.) |
| Boiling point: | 381.2±22.0 °C(Predicted) |
| Density | 1.211±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.49±0.10(Predicted) |
| form | Crystalline |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C13H10N2/c1-9-6-8-15-13-11(9)5-4-10-3-2-7-14-12(10)13/h2-8H,1H3 |
| InChIKey | NAZZKEZTSOOCSZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C3C=2N=CC=C3)C(C)=CC=1 |
| EPA Substance Registry System | 1,10-Phenanthroline, 4-methyl- (31301-28-7) |
Description and Uses
4-methyl-1,10-phenanthroline can be used to produce 1,10-Phenanthrolin-4-aldehyde.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




