A5505112
5-Methoxyisophthalic Acid , >98.0%(GC) , 46331-50-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB117.60 | In Stock |
|
| 5G | RMB382.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275-280 °C (lit.) |
| Boiling point: | 270 °C |
| Density | 1.416±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 3.41±0.10(Predicted) |
| color | Off-White |
| InChI | 1S/C9H8O5/c1-14-7-3-5(8(10)11)2-6(4-7)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | POSMIIJADZKUPL-UHFFFAOYSA-N |
| SMILES | COc1cc(cc(c1)C(O)=O)C(O)=O |
| CAS DataBase Reference | 46331-50-4(CAS DataBase Reference) |
Description and Uses
5-Methoxyisophthalic acid (MeO-H2ip) may be used to synthesize [bpp = 1,3-di(4-pyridyl)propane]:
- 5-methoxy bis(4-benzyloxy)phenylisophthalate
- 3,5-bis(4-fluorobenzoyl)phenol
- [Cd2(MeO-ip)2(bpp)2]n·nH2O
- [Ni(MeO-ip)(bpp)(H2O)]n·nH2O
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 13 - Non Combustible Solids |






