A5506912
4-Methoxy-2-nitrobenzoic acid , 97% , 33844-21-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB140.80 | In Stock |
|
| 25g | RMB555.20 | In Stock |
|
| 100g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196.5-200.5 °C (lit.) |
| Boiling point: | 372.9±27.0 °C(Predicted) |
| Density | 1.430±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.46±0.25(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | 1S/C8H7NO5/c1-14-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | DVZBWONCSHFMMM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)=O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 33844-21-2(CAS DataBase Reference) |
Description and Uses
4-Methoxy-2-nitrobenzoic acid can serve as a key step in chemical reactions for synthesizing certain drug molecules, or play a role in the synthesis of certain types of dyes, fragrances, and other chemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 2 |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
