A5521212
3-Methyl-2-nitrobenzoic acid , 98% , 5437-38-7
Synonym(s):
2-Nitro-m-toluic acid
CAS NO.：5437-38-7
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007180
EINECS: 226-610-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB87.20 | In Stock |
|
| 250g | RMB175.20 | In Stock |
|
| 500G | RMB311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-223 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.26±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 1960698 |
| InChI | InChI=1S/C8H7NO4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | DGDAVTPQCQXLGU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 5437-38-7(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Methyl-2-nitrobenzoic acid (5437-38-7) |
Description and Uses
2-Nitro-m-toluic Acid, is a building block used for the synthesis of various compounds. It can be used for the synthesis of novel Indolin-2-one derivatives as protein tyrosine phosphatase 1B inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22-37 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163990 |
