LN1499839
98% , 871360-40-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1296.00 | In Stock |
|
| 250mg | RMB2160.00 | In Stock |
|
| 1g | RMB4320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 436.4±55.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 8.47±0.10(Predicted) |
| Appearance | White Solid |
| InChI | InChI=1S/C14H20N2O3S/c1-9(2)12-8-19-14(15-12)11-7-5-6-10(3)13(11)16-20(4,17)18/h5-7,9,12,16H,8H2,1-4H3/t12-/m0/s1 |
| InChIKey | KCLDECJIUSCXOX-LBPRGKRZSA-N |
| SMILES | CS(NC1=C(C)C=CC=C1C1=N[C@H](C(C)C)CO1)(=O)=O |
Description and Uses
It is a buliding block used in synthesis of various compounds such as Carolacton, a highly potent biofilm inhibitor.
