A5507012
4-Methyl-2-nitrobenzoic acid , 97% , 27329-27-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB235.20 | In Stock |
|
| 25g | RMB847.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-164 °C (lit.) |
| Boiling point: | 367.6±30.0 °C(Predicted) |
| Density | 1.392±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.36±0.25(Predicted) |
| form | powder |
| color | Brown |
| InChI | 1S/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | KZLLSSGOPIGKDO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(O)=O)c(c1)[N+]([O-])=O |
Description and Uses
4-Methyl-2-nitrobenzoic acid is a chemical that can be used for wastewater treatment.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-43 |
| Safety Statements | 37/39 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
