A6318812
Nitroterephthalic Acid , ≥98.0% , 610-29-7
CAS NO.:610-29-7
Empirical Formula: C8H5NO6
Molecular Weight: 211.13
MDL number: MFCD00007141
EINECS: 210-217-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 100G | RMB294.40 | In Stock |
|
| 500g | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-272 °C (lit.) |
| Boiling point: | 350.79°C (rough estimate) |
| Density | 1.6342 (rough estimate) |
| refractive index | 1.5282 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | pK1:1.73 (25°C) |
| form | Powder |
| color | White to light beige |
| BRN | 1913836 |
| InChI | InChI=1S/C8H5NO6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | QUMITRDILMWWBC-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 610-29-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Nitroterephthalic acid (610-29-7) |
Description and Uses
Nitroterephthalic acid is used as a ligand in the synthesis of MOF materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





