A5507212
Methyl 3-Nitroanthranilate , >98.0%(GC) , 57113-91-4
CAS NO.:57113-91-4
Empirical Formula: C8H8N2O4
Molecular Weight: 196.16
MDL number: MFCD02093531
EINECS: 671-056-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB132.80 | In Stock |
|
| 25G | RMB434.40 | In Stock |
|
| 100G | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-98°C |
| Boiling point: | 340.1±22.0 °C(Predicted) |
| Density | 1.386±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Ethyl Acetate |
| pka | -2.80±0.25(Predicted) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C8H8N2O4/c1-14-8(11)5-3-2-4-6(7(5)9)10(12)13/h2-4H,9H2,1H3 |
| InChIKey | HDCLJQZLTMJECA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC([N+]([O-])=O)=C1N |
| CAS DataBase Reference | 57113-91-4(CAS DataBase Reference) |
Description and Uses
Methyl 2-amino-3-nitrobenzoate is used as an intermediate in the preparation of Candesartan.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






