A5515212
5-Methylindole-2-carboxylic acid , ≥98.0% , 10241-97-1
Synonym(s):
NSC 88873
CAS NO.:10241-97-1
Empirical Formula: C10H9NO2
Molecular Weight: 175.18
MDL number: MFCD00047166
EINECS: 680-894-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-238°C (dec.) |
| Boiling point: | 236 °C(Press: 4.0 Torr) |
| Density | 1.340±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.48±0.30(Predicted) |
| Appearance | Off-white to light brown Solid |
| Water Solubility | Soluble in ethanol (50 mg/ml). Insoluble in water. |
| BRN | 144055 |
| InChI | InChI=1S/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
| InChIKey | DAITVOCMWPNFTL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(C)C=C2)C=C1C(O)=O |
| CAS DataBase Reference | 10241-97-1(CAS DataBase Reference) |
Description and Uses
5-Methylindole-2-carboxylic acid is a compound used in the synthesis of Pin1 inhibitors as potential antitumor agents. reactant in preparation of Pin1 inhibitors as potential antitumor agents reactant in preparation of non-imidazole human histamine H4 receptor antagonists
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 13 - Non Combustible Solids |






