A5517012
M344 , ≥97% , 251456-60-7
Synonym(s):
4-(Dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]-benzamide;Histone Deacetylase Inhibitor III;N-Hydroxy-7-(4-dimethylaminobenzoyl)-aminoheptanamide
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB321.60 | In Stock |
|
| 20mg | RMB520.00 | In Stock |
|
| 25MG | RMB1072.00 | In Stock |
|
| 100MG | RMB2090.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161℃ |
| Density | 1.137±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble10mg/mL, clear |
| pka | 9.48±0.20(Predicted) |
| form | White solid |
| color | white to beige |
| Sensitive | Light Sensitive |
| InChI | 1S/C16H25N3O3/c1-19(2)14-10-8-13(9-11-14)16(21)17-12-6-4-3-5-7-15(20)18-22/h8-11,22H,3-7,12H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | MXWDSZWTBOCWBK-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(=O)NCCCCCCC(=O)NO |
| CAS DataBase Reference | 251456-60-7 |
Description and Uses
Histone deacetylase inhibitor III. A cell-permeable amide analog of Trichostatin A that potently inhibits HDACs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P302+P352-P305+P351+P338-P321-P405-P501 |
| WGK Germany | 3 |
| HS Code | 2928.00.2500 |
| Storage Class | 11 - Combustible Solids |




