A5521712
Methoxychlor Standard , 1000ug/mlinPurgeandTrapMethanol , 72-43-5
Synonym(s):
1,1,1-Trichloro-2,2-bis-(p-methoxyphenyl)ethane;2,2-Bis(4-methoxyphenyl)-1,1,1-trichloroethane;DMDT
CAS NO.:72-43-5
Empirical Formula: C16H15Cl3O2
Molecular Weight: 345.65
MDL number: MFCD00000803
EINECS: 200-779-9
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C(lit.) |
| Boiling point: | 346 °C |
| Density | 1.41 g/cm3 (25℃) |
| vapor pressure | Very low |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | Soluble in ethanol (Windholz et al., 1983), chloroform (440 g/kg), xylene (440 g/kg), and
methanol (50 g/kg) (Worthing and Hance, 1991) |
| Water Solubility | 0.1 mg l-1 (25 °C) |
| form | crystalline |
| color | yellow |
| Merck | 14,5990 |
| BRN | 2057367 |
| Exposure limits | NIOSH REL: IDLH 5,000 mg/m3; OSHA PEL: TWA 15 mg/m3;
ACGIH TLV: TWA 10 mg/m3. |
| Stability: | Stable, but light sensitive. Combustible at high temperature. Corrodes aluminium and iron slowly. |
| Major Application | agriculture environmental |
| InChI | 1S/C16H15Cl3O2/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12/h3-10,15H,1-2H3 |
| InChIKey | IAKOZHOLGAGEJT-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)C(c2ccc(OC)cc2)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 72-43-5(CAS DataBase Reference) |
| IARC | 3 (Vol. 20, Sup 7) 1987 |
| EPA Substance Registry System | Methoxychlor (72-43-5) |
Description and Uses
Methoxychlor is a structural analogue of DDT but is not as persistent in the environment as DDT.
Insecticide used to control mosquito larvae, house flies and other insect pests in field crops, fruits and vegetables; to control ecto-parasites on cattle, sheep and goats; recommended for use in dairy barns.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H361fd-H410 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,T,F,N |
| Risk Statements | 20/21/22-40-39/23/24/25-23/24/25-11-67-65-50/53-38 |
| Safety Statements | 7-23-36/37/39-45-16-62-61-60-33-29-9-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | KJ3675000 |
| HS Code | 2909.30.3000 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 72-43-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 5.0 g/kg (Hodge) |
| IDLA | 5,000 mg/m3 |






