A5523712
                    Mianserin HCl , ≥98% , 21535-47-7
                            Synonym(s):
1,2,3,4,10,14b-Hexahydro-2-methyl-dibenzo[c,f]pyrazino[1,2-a]azepine hydrochloride;Mianserin hydrochloride
                            
                        
                CAS NO.:21535-47-7
Empirical Formula: C18H21ClN2
Molecular Weight: 300.83
MDL number: MFCD00055072
EINECS: 244-426-7
| Pack Size | Price | Stock | Quantity | 
| 50MG | RMB97.60 | In Stock | 
                                                 | 
                                        
| 250MG | RMB232.80 | In Stock | 
                                                 | 
                                        
| 1G | RMB416.80 | In Stock | 
                                                 | 
                                        
| 200mg | RMB444.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB896.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | >230oC (dec.) | 
                                    
| Flash point: | 9℃ | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | H2O: 3.4 mg/mL | 
                                    
| form | Solid | 
                                    
| color | Off-White to Pale Yellow | 
                                    
| Water Solubility | Soluble in water, ethanol, methanol, and dimethylformamide. | 
                                    
| Merck | 14,6172 | 
                                    
| InChI | InChI=1S/C18H20N2.ClH/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19;/h2-9,18H,10-13H2,1H3;1H | 
                                    
| InChIKey | YNPFMWCWRVTGKJ-UHFFFAOYSA-N | 
                                    
| SMILES | N12CCN(C)CC1C1=CC=CC=C1CC1C=CC=CC2=1.Cl | 
                                    
| CAS DataBase Reference | 21535-47-7(CAS DataBase Reference) | 
                                    
Description and Uses
Mianserin hydrochloride is a tetracyclic antidepressant with an EEG and clinical activity profile similar to amitriptyline. It may cause drowsiness and hematological problems. Its mechanism of therapeutic action is not well understood, although it apparently blocks alpha-adrenergic, histamine H1, and some types of serotonin receptors.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P301+P312+P330 | 
| Hazard Codes | Xn,Xi,T,F | 
| Risk Statements | 22-39/23/24/25-23/24/25-11 | 
| Safety Statements | 7-16-36/37-45 | 
| RIDADR | 3249 | 
| WGK Germany | 3 | 
| RTECS | HP8780000 | 
| HS Code | 2933.59.8000 | 
| HazardClass | 6.1(b) | 
| PackingGroup | III | 
| Toxicity | LD50 in male, female mice (mg/kg): 365, 390 orally; 32.5, 31.0 i.v. (van Riezen) | 





![[2-(4-methyl-2-phenylpiperazin-1-yl)phenyl]methanol](https://img.chemicalbook.com/CAS/20200401/GIF/57321-32-1.gif)

