A5524812
Milnacipran hydrochloride , ≥99% , 101152-94-7
Synonym(s):
(1R,2S)-rel-2-(Aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide monohydrochloride;F 2207;Midalcipran;Toledomin
CAS NO.:101152-94-7
Empirical Formula: C15H23ClN2O
Molecular Weight: 282.81
MDL number: MFCD00901293
EINECS: 620-477-4
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB31.20 | In Stock |
|
| 50MG | RMB71.20 | In Stock |
|
| 250MG | RMB255.20 | In Stock |
|
| 500mg | RMB415.20 | In Stock |
|
| 1g | RMB663.20 | In Stock |
|
| 5g | RMB2319.20 | In Stock |
|
| 25g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-1810C |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | H2O: 19 mg/mL |
| form | solid |
| color | white |
| Water Solubility | H2O: 19mg/mL |
| Merck | 14,6194 |
| InChI | InChI=1/C15H22N2O.ClH/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12;/h5-9,13H,3-4,10-11,16H2,1-2H3;1H/t13-,15+;/s3 |
| InChIKey | XNCDYJFPRPDERF-DPKVYHSMNA-N |
| SMILES | [C@@]1(C(=O)N(CC)CC)(C[C@H]1CN)C1C=CC=CC=1.Cl |&1:0,9,r| |
| CAS DataBase Reference | 101152-94-7(CAS DataBase Reference) |
Description and Uses
Milnacipran Hydrochloride is an antidepressant. A selective norepinephrine and serotonin reuptake inhibitor approved for the management of fibromyalgia.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ1014010 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29242990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orally in mice: 237 mg/kg (Bonnaud) |







