A5528912
2-Methoxy-5-(trifluoromethyl)aniline , >98.0%(GC) , 349-65-5
Synonym(s):
6-Methoxy-α,α,α-trifluoro-m-toluidine
CAS NO.:349-65-5
Empirical Formula: C8H8F3NO
Molecular Weight: 191.15
MDL number: MFCD00042486
EINECS: 626-005-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB115.20 | In Stock |
|
| 100G | RMB362.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60 °C (lit.) |
| Boiling point: | 230.1±40.0 °C(Predicted) |
| Density | 1.2645 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.31±0.10(Predicted) |
| form | Crystalline Powder |
| color | Beige-gray to brown |
| BRN | 2835713 |
| InChI | InChI=1S/C8H8F3NO/c1-13-7-3-2-5(4-6(7)12)8(9,10)11/h2-4H,12H2,1H3 |
| InChIKey | RKUSRLUGUVDNKP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC=C1OC |
| CAS DataBase Reference | 349-65-5(CAS DataBase Reference) |
Description and Uses
2-Methoxy-5-(trifluoromethyl)aniline may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




