PRODUCT Properties
| Melting point: | 300-305 °C (lit.) |
| Boiling point: | 260.22°C (rough estimate) |
| Density | 1.1798 (rough estimate) |
| refractive index | 1.8070 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Acetonitrile (Slightly), DMSO (Slightly) |
| pka | 4.56±0.10(Predicted) |
| form | Crystals |
| color | Beige |
| InChI | InChI=1S/C6H7N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h2-3H,1H3,(H2,7,8,9) |
| InChIKey | WRXCXOUDSPTXNX-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC=NC=2N)N(C)C=1 |
Description and Uses
9-Methyladenine is a receptor adenine derivative binding membrane brain animal cell line. It may be used in the preparation of N6-benzoyl-9-methyladenine.
