A5533912
Methyl 4-Bromo-3-methylbenzoate , ≥97.0%(GC) , 148547-19-7
CAS NO.：148547-19-7
Empirical Formula: C9H9BrO2
Molecular Weight: 229.07
MDL number: MFCD00673014
EINECS: 629-103-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB142.40 | In Stock |
|
| 100G | RMB493.60 | In Stock |
|
| 500g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-44 °C (lit.) |
| Boiling point: | 287.4±20.0 °C(Predicted) |
| Density | 1.433±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Low Melting Solid or Liquid |
| color | White to yellow |
| BRN | 6593534 |
| InChI | InChI=1S/C9H9BrO2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5H,1-2H3 |
| InChIKey | GTZTYNPAPQKIIR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 148547-19-7(CAS DataBase Reference) |
Description and Uses
Methyl 4-bromo-3-methylbenzoate may be used in the preparation of:
- 4-bromo-3-vinylbenzoic acid
- 4-bromo-3-(methylphenyl)methanol
- methyl (E)-4-bromo-3-[(phenylmethoxyimino)methyl]benzoate
It may be used as a starting material in the total synthesis of (-)-martinellic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
