A5623612
Methyl 3-Bromo-4-methylbenzoate , >98.0% , 104901-43-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB56.00 | In Stock |
|
| 10g | RMB97.60 | In Stock |
|
| 25G | RMB180.80 | In Stock |
|
| 100g | RMB546.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-44 °C(lit.) |
| Boiling point: | 130°C/0.1mmHg(lit.) |
| Density | 1.433±0.06 g/cm3(Predicted) |
| refractive index | 1.5570 to 1.5610 |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide. |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C9H9BrO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,1-2H3 |
| InChIKey | MASRAGFWFYHMFI-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C)C(Br)=C1 |
| CAS DataBase Reference | 104901-43-1(CAS DataBase Reference) |
Description and Uses
It is a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
