A5537112
2-Methoxy-3-nitropyridine , ≥98.0%(GC) , 20265-35-4
CAS NO.:20265-35-4
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00023459
EINECS: 654-159-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB45.60 | In Stock |
|
| 5G | RMB137.60 | In Stock |
|
| 25G | RMB405.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55°C |
| Boiling point: | 247.9±20.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -0+-.0.10(Predicted) |
| color | White to Amber |
| BRN | 138199 |
| InChI | InChI=1S/C6H6N2O3/c1-11-6-5(8(9)10)3-2-4-7-6/h2-4H,1H3 |
| InChIKey | WZNQCVOSOCGWJG-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 20265-35-4(CAS DataBase Reference) |
Description and Uses
2-Methoxy-3-nitropyridine is a pyridine compound used as a reagent in chemical reactions or as an intermediate component in organic synthesis. It can be reduced to amines and then converted to N-substituted derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H319-H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-41-37/38 |
| Safety Statements | 26-36/37/39-22-36-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







