A5539112
1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridineHydrochloride , ≥98% , 23007-85-4
Synonym(s):
Dopaminergic neurotoxin, MPTP;MPTP hydrochloride;MPTP Hydrochloride - CAS 23007-85-4 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB248.80 | In Stock |
|
| 100MG | RMB911.20 | In Stock |
|
| 500MG | RMB1829.60 | In Stock |
|
| 1g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249.0 to 254.0 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | White solid |
| color | white to off-white |
| Water Solubility | water: 100mg/mL |
| BRN | 3707312 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C12H15N.ClH/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-7H,8-10H2,1H3;1H |
| InChIKey | KOWJANGMTAZWDT-UHFFFAOYSA-N |
| SMILES | C1(=CCN(C)CC1)C1C=CC=CC=1.Cl |
| CAS DataBase Reference | 23007-85-4 |
Description and Uses
MPTP is a neurotoxin used to cause selective destruction of dopaminergic neurons in animal models of parkinsonism. MPTP is metabolized by monoamine oxidase B to produce MPDP+ and MPP+, with MP+ being the active toxic agent. MPP+ induces neurotoxicity primarily by inhibiting complex I of the mitochondrial electron transport chain, resulting in ATP depletion and increased oxidative stress. The key features of different neurotoxic models of Parkinson’s disease, including the MPTP model, have been detailed.[Cayman Chemical]
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H370 |
| Precautionary statements | P260-P264-P270-P301+P310-P405-P501 |
| target organs | Nervous system |
| Hazard Codes | T |
| Risk Statements | 25-39/23/24/25-36/37/38 |
| Safety Statements | 45-39-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UT8358950 |
| HS Code | 2933.39.9200 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral STOT SE 1 |







