A6672512
3-Pyridylacetic Acid Hydrochloride , 99% , 6419-36-9
Synonym(s):
3-Pyridineacetic acid hydrochloride
CAS NO.:6419-36-9
Empirical Formula: C7H8ClNO2
Molecular Weight: 173.6
MDL number: MFCD00012819
EINECS: 229-148-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB493.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-163 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to light yellow or beige |
| Merck | 14,7971 |
| BRN | 3696630 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)4-6-2-1-3-8-5-6;/h1-3,5H,4H2,(H,9,10);1H |
| InChIKey | XVCCOEWNFXXUEV-UHFFFAOYSA-N |
| SMILES | C(C1=CN=CC=C1)C(=O)O.Cl |
| CAS DataBase Reference | 6419-36-9(CAS DataBase Reference) |
Description and Uses
3-Pyridineacetic acid hydrochloride is a higher homologue of nicotinic acid, a breakdown product of nicotine (and other tobacco alkaloids).
These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





