A6724012
4-Pyridylboronic Acid (contains varying amounts of Anhydride) , ≥96.0% , 1692-15-5
Synonym(s):
4-Pyridineboronic acid;4-Pyridylboronic acid
CAS NO.:1692-15-5
Empirical Formula: C5H6BNO2
Molecular Weight: 122.92
MDL number: MFCD01074545
EINECS: 671-679-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB272.00 | In Stock |
|
| 100G | RMB925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 308.8±34.0 °C(Predicted) |
| Density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Aqueous Acid (Slightly), Water (Slightly) |
| form | Solid |
| pka | 7.59±0.10(Predicted) |
| color | White to Off-White |
| BRN | 471944 |
| InChI | InChI=1S/C5H6BNO2/c8-6(9)5-1-3-7-4-2-5/h1-4,8-9H |
| InChIKey | QLULGIRFKAWHOJ-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(B(O)O)=C1 |
| CAS DataBase Reference | 1692-15-5(CAS DataBase Reference) |
Description and Uses
Pyridine-4-boronic acid is a kind of boronic acid derivative. It is useful building blocks in crystal engineering. It can also be used as a catalyst to act as a dehydrative condensation agent to synthesize amides using carboxylic acid and amines as raw materials. Its derivative, polystyrene-bound 4-pyridineboronic acid, is a useful catalyst for amidation reaction and esterification of alpha-hydrocarboxylic acids.
Boronic acid derivatives and their binding affinities with diols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 36/37/38-22-34-11 |
| Safety Statements | 22-24/25-36/37/39-26-45-16 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






