A5549012
(1-Methyl-4-piperidinyl)methylamine , 95% , 7149-42-0
CAS NO.:7149-42-0
Empirical Formula: C7H16N2
Molecular Weight: 128.22
MDL number: MFCD05022430
EINECS: 230-477-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB57.60 | In Stock |
|
| 1G | RMB168.00 | In Stock |
|
| 5G | RMB568.72 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 0°C |
| Boiling point: | 80 °C |
| Density | 0.901±0.06 g/cm3(Predicted) |
| Flash point: | 0°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | liquid |
| pka | 10.13±0.29(Predicted) |
| color | Pale yellow |
| InChI | InChI=1S/C7H16N2/c1-9-4-2-7(6-8)3-5-9/h7H,2-6,8H2,1H3 |
| InChIKey | AGTPSAZJSOQXHJ-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(CN)CC1 |
| CAS DataBase Reference | 7149-42-0(CAS DataBase Reference) |
Description and Uses
(1-methyl-4-piperidinyl)methanamine is a reagent used in the synthesis of novel indole-carboxamides which are inhibitors of neurotropic alphavirus.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P370+P378-P403+P235 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-20/22-22-10 |
| Safety Statements | 26-36/37/39-45-23 |
| RIDADR | 2735 |
| WGK Germany | 1 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1C |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









