S8989414
1841-19-6
Synonym(s):
8-[4,4-bis(p-Fluorophenyl)butyl]-1-phenyl-1,3,8-triazino[4.5]decan-4-one;R 6218
CAS NO.:1841-19-6
Empirical Formula: C29H31F2N3O
Molecular Weight: 475.57
MDL number: MFCD00055137
EINECS: 217-418-6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1556.26 | In Stock |
|
| 50mg | RMB6212.91 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187.5-190° |
| Boiling point: | 668.9±55.0 °C(Predicted) |
| Density | 1.1634 (estimate) |
| storage temp. | room temp |
| solubility | DMSO: soluble |
| form | amorphous solid |
| pka | 15.05±0.20(Predicted) |
| color | white to yellow |
| InChIKey | QOYHHIBFXOOADH-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1)C(CCCN2CCC3(CC2)N(CNC3=O)c4ccccc4)c5ccc(F)cc5 |
| CAS DataBase Reference | 1841-19-6 |
Description and Uses
Fluspirilene is a potent, non-competitive antagonist of agonist-
This drug is primarily used for supportive therapy of patients suffering from chronic mental illnesses after treatment in the hospital. It is suitable for use in ambulatory practice because of the lack of expressed hypno-sedative effects.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H410-H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P273-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | XX8750000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 i.m. in rats: 146 ±14 mg/kg (Janssen) |







