A5550212
Methyl 3-methylpyridine-2-carboxylate , 97% , 59718-84-2
Synonym(s):
3-Methylpicolinic acid, methyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1G | RMB58.32 | In Stock |
|
| 5G | RMB168.80 | In Stock |
|
| 25G | RMB572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73°C/2mmHg(lit.) |
| Density | 1.121 g/mL at 25 °C |
| refractive index | n20/D 1.516 |
| Flash point: | 110 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 2.19±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C8H9NO2/c1-6-4-3-5-9-7(6)8(10)11-2/h3-5H,1-2H3 |
| InChIKey | CCQFKEITVOTHIW-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=CC=C1C |
| CAS DataBase Reference | 59718-84-2 |
Description and Uses
Methyl 3-Methylpyridine-2-carboxylate is a building block that has been used in the synthesis of pyrrolo[3,4-b]pyridin-7(6H)-one derivatives as melanin concentrating hormone receptor 1 (MCH-R1) antagonists.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
