A5552412
Methyl Pentafluorobenzoate , ≥97.0%(GC) , 36629-42-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| 100g | RMB880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 223℃ |
| Density | 1.532 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 173 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.532 |
| InChI | 1S/C8H3F5O2/c1-15-8(14)2-3(9)5(11)7(13)6(12)4(2)10/h1H3 |
| InChIKey | UXJRQNXHCZKHRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 36629-42-2(CAS DataBase Reference) |
Description and Uses
Methyl pentafluorobenzoate was used in preparation of photocoupling agent, based on perfluorophenylazide (PFPA)-conjugated polyallylamine, for efficient immobilization of polymers, nanoparticles, graphene and small molecules. It was also used in preparation of photoactive reagent N-hydroxysuccinimide (NHS)-PFPA.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-28-24/25-23 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Excepted Quantities | Non-Hazardous |






