A5552612
4-Methoxy-3-(trifluoromethyl)aniline , 98% , 393-15-7
CAS NO.:393-15-7
Empirical Formula: C8H8F3NO
Molecular Weight: 191.15
MDL number: MFCD00043460
EINECS: 670-719-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB72.00 | In Stock |
|
| 5G | RMB199.20 | In Stock |
|
| 25G | RMB669.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28 °C |
| Boiling point: | 112 °C |
| Density | 1.280±0.06 g/cm3(Predicted) |
| Flash point: | 112°C/18mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 3.98±0.10(Predicted) |
| Appearance | Yellow to brown Solid |
| BRN | 2723972 |
| InChI | InChI=1S/C8H8F3NO/c1-13-7-3-2-5(12)4-6(7)8(9,10)11/h2-4H,12H2,1H3 |
| InChIKey | CQJCPOVTPNWVBW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 393-15-7(CAS DataBase Reference) |
Description and Uses
4-Methoxy-3-(trifluoromethyl)aniline is a fluorinated aniline derivative used as a pharmaceutical intermediate for the synthesis of antibacterial and antiparasitic quinoxaline-2,3-diamine derivatives.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 20/21/22-36/37/38-52-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | TOXIC |
| HazardClass | 6.1 |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






