A5553012
5-Methyl-2-thiouracil , ≥98.0% , 636-26-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB111.20 | In Stock |
|
| 10G | RMB191.20 | In Stock |
|
| 25g | RMB383.20 | In Stock |
|
| 50G | RMB719.20 | In Stock |
|
| 100g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 283-286°C |
| Density | 1.36 |
| refractive index | 1.6430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pKa 7.71 (Uncertain) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 509mg/L(25 ºC) |
| BRN | 120488 |
| Stability: | Stable but may be heat or light sensitive. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | ZLAQATDNGLKIEV-UHFFFAOYSA-N |
| SMILES | C1(=S)NC=C(C)C(=O)N1 |
| CAS DataBase Reference | 636-26-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4(1H)-pyrimidinone, 2,3-dihydro-5-methyl-2-thioxo-(636-26-0) |
| EPA Substance Registry System | 5-Methyl-2-thiouracil (636-26-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 22-40-36/37/38 |
| Safety Statements | 22-36/37-26 |
| RTECS | XP2108500 |
| HS Code | 2933599590 |
