A5555412
4-Methoxybenzophenone , ≥98.0%(GC) , 611-94-9
CAS NO.：611-94-9
Empirical Formula: C14H12O2
Molecular Weight: 212.24
MDL number: MFCD00008403
EINECS: 210-285-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB119.20 | In Stock |
|
| 500G | RMB523.20 | In Stock |
|
| 2.5kg | RMB2315.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C (lit.) |
| Boiling point: | 354-356 °C (lit.) |
| Density | 1.1035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 354-356°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | Crystalline Solid |
| color | White to yellow-orange |
| Water Solubility | Insoluble in water. |
| BRN | 1104713 |
| InChI | InChI=1S/C14H12O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | SWFHGTMLYIBPPA-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 611-94-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (4-methoxyphenyl)phenyl-(611-94-9) |
Description and Uses
4-Methoxybenzophenone and its analogues showed diverse plant growth-regulating actions such as inhibition of shoot and root growth, induction of chlorosis, and a disturbance in phototropism or geotropism. It is also used as a photo polymerization catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | PC4962500 |
| Hazard Note | Irritant |
| HS Code | 29145000 |
