A5558912
5-Allyl-3-methoxysalicylic Acid Methyl Ester , ≥98.0%(GC) , 85614-43-3
CAS NO.:85614-43-3
Empirical Formula: C12H14O4
Molecular Weight: 222.24
MDL number: MFCD04038819
EINECS: 287-929-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB128.00 | In Stock |
|
| 100G | RMB457.60 | In Stock |
|
| 500g | RMB1836.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-58 °C (lit.) |
| Boiling point: | 174°C/12mmHg(lit.) |
| Density | 1.144±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 10.10±0.23(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H14O4/c1-4-5-8-6-9(12(14)16-3)11(13)10(7-8)15-2/h4,6-7,13H,1,5H2,2-3H3 |
| InChIKey | LYSUGZLJKRSLHM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CC=C)cc(OC)c1O |
| CAS DataBase Reference | 85614-43-3(CAS DataBase Reference) |
Description and Uses
Methyl 5-Allyl-3-methoxysalicylate is a reactant in the synthesis of Fallypride (F101115), enterobactin scaffolds and allylic amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





