BD7703831
Methyl 2-mercaptobenzoate , 97% , 4892-02-8
Synonym(s):
Methyl 2-mercaptobenzoate
CAS NO.:4892-02-8
Empirical Formula: C8H8O2S
Molecular Weight: 168.21
MDL number: MFCD00060678
EINECS: 628-716-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB92.80 | In Stock |
|
| 10g | RMB157.60 | In Stock |
|
| 25g | RMB384.80 | In Stock |
|
| 100g | RMB1489.60 | In Stock |
|
| 500g | RMB5888.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164 °C |
| Boiling point: | 98-100 °C/2 mmHg (lit.) |
| Density | 1.223 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 5.84±0.43(Predicted) |
| form | Liquid |
| Specific Gravity | 1.223 |
| color | Clear colorless to light yellow or light green |
| Sensitive | Air Sensitive |
| Stability: | Air Sensitive |
| InChI | InChI=1S/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,11H,1H3 |
| InChIKey | BAQGCWNPCFABAY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S |
| CAS DataBase Reference | 4892-02-8(CAS DataBase Reference) |
Description and Uses
Methyl thiosalicylate may be used:
- in the synthesis of thioxanthone, an efficient enantioselective organocatalyst for the intramolecular [2+2] photocycloaddition reaction
- as anionic bidentate ligand, in the preparation of ′2+1′ type complexes of [(99m)Tc]-tricarbonyltechnetium(I) and [(188)Re]-tricarbonylrhenium(I)
- in the synthesis of a series of benzisothiazolone derivatives
- in the synthesis of a new fused benzoheterocyclic compound, [1]benzothieno[3,2-b]furan
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DH3500000 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




