A5559512
4-(4-methylpiperazino)benzaldehyde , ≥98.0%(GC) , 27913-99-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB163.20 | In Stock |
|
| 25G | RMB656.00 | In Stock |
|
| 100g | RMB2464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57 °C |
| Boiling point: | 351.3±37.0 °C(Predicted) |
| Density | 1.107±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.63±0.42(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C12H16N2O/c1-13-6-8-14(9-7-13)12-4-2-11(10-15)3-5-12/h2-5,10H,6-9H2,1H3 |
| InChIKey | PFODEVGLOVUVHS-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N2CCN(C)CC2)C=C1 |
| CAS DataBase Reference | 27913-99-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 2912290090 |




![1-(4-(4-[3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL]PIPERAZINO)PHENYL)-1-ETHANONE](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB4403601.gif)
