A5561912
8-Methoxypsoralen , 98% , 298-81-7
Synonym(s):
Xanthotoxin;Methoxsalen;8-Methoxypsoralen;8-MOP;Ammoidin
CAS NO.:298-81-7
Empirical Formula: C12H8O4
Molecular Weight: 216.19
MDL number: MFCD00005009
EINECS: 206-066-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB31.20 | In Stock |
|
| 1G | RMB102.40 | In Stock |
|
| 5G | RMB387.20 | In Stock |
|
| 25G | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 276.6°C (rough estimate) |
| Density | 1.1344 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: slightly soluble |
| form | Needle-Like Crystals or Powder |
| color | white to yellow |
| Water Solubility | PRACTICALLY INSOLUBLE |
| Merck | 14,5988 |
| BRN | 196453 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
| InChIKey | QXKHYNVANLEOEG-UHFFFAOYSA-N |
| SMILES | COc1c2OC(=O)C=Cc2cc3ccoc13 |
| LogP | 1.523 (est) |
| CAS DataBase Reference | 298-81-7(CAS DataBase Reference) |
| IARC | 1 (Vol. 24, Sup 7, 100A) 2012 |
| NIST Chemistry Reference | Methoxsalen(298-81-7) |
| EPA Substance Registry System | Methoxsalen (298-81-7) |
Description and Uses
8-Methoxypsoralen (8-MOP) and other psoralens are naturally found in plants, including common fruit and vegetable crops.
A potent suicide inhibitor of cytochrome P-450.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H341-H351 |
| Precautionary statements | P202-P261-P280-P301+P312-P302+P352-P308+P313 |
| Hazard Codes | Xn,T |
| Risk Statements | 22-43-46-45-34 |
| Safety Statements | 36/37-53-45-36/37/39-26 |
| RIDADR | 3216 |
| WGK Germany | 3 |
| RTECS | LV1400000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Muta. 2 Skin Sens. 1 |
| Hazardous Substances Data | 298-81-7(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in rats: 470 ±30 mg/kg (Hakim) |





