A5562712
2-Methoxybenzenesulfonyl chloride, 97% , 95% , 10130-87-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB112.00 | In Stock |
|
| 1G | RMB211.20 | In Stock |
|
| 5g | RMB479.20 | In Stock |
|
| 25g | RMB2319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-54°C |
| Boiling point: | 126-129 °C(Press: 0.3 Torr) |
| Density | 1.376 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Light brown to brown Solid |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H7ClO3S/c1-11-6-4-2-3-5-7(6)12(8,9)10/h2-5H,1H3 |
| InChIKey | GYOBZOBUOMDRRN-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1OC |
| CAS DataBase Reference | 10130-87-7 |
Description and Uses
For synthesis and pharmacological evaluation of sulfonamide derivatives of thiazolidin-4-ones 5-Bromo-2-methoxybenzenesulfonyl chloride is used.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 3261 |
| HazardClass | IRRITANT |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 2930909899 |
