A5564712
5-Methyl-2-(2-nitroanilino)-3-thiophenecarbonitrile , ≥97.0%(GC) , 138564-59-7
Synonym(s):
5-Methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile
CAS NO.:138564-59-7
Empirical Formula: C12H9N3O2S
Molecular Weight: 259.28
MDL number: MFCD06408054
EINECS: 421-300-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 10g | RMB116.00 | In Stock |
|
| 25G | RMB238.40 | In Stock |
|
| 100g | RMB726.40 | In Stock |
|
| 500g | RMB2194.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109.0 to 115.0 °C |
| Boiling point: | 425.4±45.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | -3.24±0.50(Predicted) |
| form | solid |
| color | Light yellow to Amber to Dark green |
| BRN | 7485862 |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C12H9N3O2S/c1-8-6-9(7-13)12(18-8)14-10-4-2-3-5-11(10)15(16)17/h2-6,14H,1H3 |
| InChIKey | NPXUFPFFHANGDL-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2[N+]([O-])=O)SC(C)=CC=1C#N |
| CAS DataBase Reference | 138564-59-7(CAS DataBase Reference) |
Description and Uses
5-Methyl-2-[(2-nitrophenyl)amino]-3-thiophenecarbonitrile is an impurity of Olanzapine (O253750). Olanzapine impurity A (EP).
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 22-50/53 |
| Safety Statements | 22-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |







