A5567512
Methyl 4-ethynylbenzoate , ≥97% , 3034-86-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB234.40 | In Stock |
|
| 25g | RMB1019.20 | In Stock |
|
| 100g | RMB3705.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-105℃ |
| Boiling point: | 239.4±23.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Sparingly soluble in water (0.16 g/L at 25°C). |
| λmax | 258nm(EtOH)(lit.) |
| InChI | InChI=1S/C10H8O2/c1-3-8-4-6-9(7-5-8)10(11)12-2/h1,4-7H,2H3 |
| InChIKey | JPGRSTBIEYGVNO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C#C)C=C1 |
Description and Uses
Methyl 4-ethynylbenzoate is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







